| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:34:43 UTC |
|---|
| Update Date | 2025-03-21 17:56:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003154 |
|---|
| Frequency | 1867.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7NO4S |
|---|
| Molecular Mass | 201.0096 |
|---|
| SMILES | NS(=O)(=O)c1ccc(C(=O)O)cc1 |
|---|
| InChI Key | UCAGLBKTLXCODC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganooxygen compoundsorganosulfonamides |
|---|
| Substituents | organosulfonic acid or derivativesbenzenesulfonamidecarboxylic acidaminosulfonyl compoundbenzoylbenzoic acid or derivativesorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amidearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundbenzoic acidorganooxygen compoundbenzenesulfonyl group |
|---|