| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:34:44 UTC |
|---|
| Update Date | 2025-03-21 17:56:43 UTC |
|---|
| HMDB ID | HMDB0003072 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003194 |
|---|
| Name | Quinic acid |
|---|
| Frequency | 1846.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H12O6 |
|---|
| Molecular Mass | 192.0634 |
|---|
| SMILES | O=C(O)C1(O)CC(O)C(O)C(O)C1 |
|---|
| InChI Key | AAWZDTNXLSGCEK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclohexanolshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidcyclohexanolhydroxy acidcarboxylic acid derivativetertiary alcoholorganic oxidemonocarboxylic acid or derivativessecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativequinic acid |
|---|
