| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:34:46 UTC |
|---|
| Update Date | 2025-03-21 17:56:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003272 |
|---|
| Frequency | 1798.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H6NO7P |
|---|
| Molecular Mass | 198.9882 |
|---|
| SMILES | NC(C(=O)O)C(=O)OP(=O)(O)O |
|---|
| InChI Key | QEYPNGNHLDJDKJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsacyl monophosphatescarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolamines |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidacyl monophosphatephosphoethanolamineorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound1,3-dicarbonyl compoundorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
