| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:34:47 UTC |
|---|
| Update Date | 2025-03-21 17:56:44 UTC |
|---|
| HMDB ID | HMDB0125529 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003333 |
|---|
| Name | 3-(3,4,5-trihydroxyphenyl)propanoic acid |
|---|
| Frequency | 1757.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O5 |
|---|
| Molecular Mass | 198.0528 |
|---|
| SMILES | O=C(O)CCc1cc(O)c(O)c(O)c1 |
|---|
| InChI Key | FWFVXNQOVGSSHX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidespyrogallols and derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidpyrogallol derivative3-phenylpropanoic-acidbenzenetriol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|