| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:49 UTC |
|---|
| Update Date | 2025-03-21 17:56:45 UTC |
|---|
| HMDB ID | HMDB0240719 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003422 |
|---|
| Name | Metanephrine sulfate |
|---|
| Frequency | 1706.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15NO6S |
|---|
| Molecular Mass | 277.062 |
|---|
| SMILES | CNCC(O)c1ccc(OS(=O)(=O)O)c(OC)c1 |
|---|
| InChI Key | WGKGYPCZXNIECS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaromatic alcoholsdialkylamineshydrocarbon derivativesmethoxybenzenesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | aromatic alcoholphenol ethermonocyclic benzene moietysulfuric acid monoesteretheralkyl aryl etherphenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundalcoholsecondary aliphatic aminesecondary aminemethoxybenzenearomatic homomonocyclic compoundorganic oxygen compoundanisolesecondary alcoholsulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compoundamine |
|---|
