| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:49 UTC |
|---|
| Update Date | 2025-03-21 17:56:45 UTC |
|---|
| HMDB ID | HMDB0246577 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003431 |
|---|
| Name | 4-Pyridoxic acid 5'-phosphate |
|---|
| Frequency | 1702.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10NO7P |
|---|
| Molecular Mass | 263.0195 |
|---|
| SMILES | Cc1ncc(COP(=O)(O)O)c(C(=O)O)c1O |
|---|
| InChI Key | FTQNPJLEFOEFIU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | pyridinecarboxylic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds2-halopyridinesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinesvinylogous acids |
|---|
| Substituents | carboxylic acidaromatic heteromonocyclic compoundpolyhalopyridinecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compound2-halopyridineazacycleheteroaromatic compoundhydroxypyridinevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyridine carboxylic acidhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
