| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:54 UTC |
|---|
| Update Date | 2025-03-21 17:56:47 UTC |
|---|
| HMDB ID | HMDB0003518 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003605 |
|---|
| Name | Homocitric acid |
|---|
| Frequency | 1613.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O7 |
|---|
| Molecular Mass | 206.0427 |
|---|
| SMILES | O=C(O)CCC(O)(CC(=O)O)C(=O)O |
|---|
| InChI Key | XKJVEVRQMLKSMO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidtricarboxylic acid or derivativeshydroxy acidtertiary alcoholorganic oxideorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|
