| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:54 UTC |
|---|
| Update Date | 2025-03-21 17:56:47 UTC |
|---|
| HMDB ID | HMDB0001458 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003609 |
|---|
| Name | Biotin amide |
|---|
| Frequency | 1623.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17N3O2S |
|---|
| Molecular Mass | 243.1041 |
|---|
| SMILES | NC(=O)CCCCC1SCC2NC(=O)NC21 |
|---|
| InChI Key | XFLVBMBRLSCJAI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | biotin and derivatives |
|---|
| Subclass | biotin and derivatives |
|---|
| Direct Parent | biotin and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethersfatty amideshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidesthienoimidazolidinesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidineprimary carboxylic acid amidefatty acylcarbonyl groupfatty amidethiophenecarboxylic acid derivativealiphatic heteropolycyclic compoundimidazolidinoneorganic oxidebiotin_derivativeorganonitrogen compoundorganopnictogen compoundcarbonic acid derivativeazacycledialkylthioetherthienoimidazolidinecarboxamide grouporganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
