| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:34:54 UTC |
|---|
| Update Date | 2025-03-21 17:56:47 UTC |
|---|
| HMDB ID | HMDB0247290 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003638 |
|---|
| Name | 7,4'-Dihydroxyflavone |
|---|
| Frequency | 1598.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O4 |
|---|
| Molecular Mass | 254.0579 |
|---|
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(O)ccc12 |
|---|
| InChI Key | LCAWNFIFMLXZPQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 7-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | monocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyran7-hydroxyflavonoidpyranone4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
