| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:34:58 UTC |
|---|
| Update Date | 2025-03-21 17:56:48 UTC |
|---|
| HMDB ID | HMDB0140804 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003782 |
|---|
| Name | 3,4,5-trihydroxy-6-[(2-phenylacetyl)oxy]oxane-2-carboxylic acid |
|---|
| Frequency | 1527.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16O8 |
|---|
| Molecular Mass | 312.0845 |
|---|
| SMILES | O=C(Cc1ccccc1)OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | ABWSRRGSWCOZTG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclepyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoid |
|---|