| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:34:59 UTC |
|---|
| Update Date | 2025-03-21 17:56:49 UTC |
|---|
| HMDB ID | HMDB0041682 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003830 |
|---|
| Name | 4-Hydroxyenterolactone |
|---|
| Frequency | 1505.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18O5 |
|---|
| Molecular Mass | 314.1154 |
|---|
| SMILES | O=C1OCC(Cc2cccc(O)c2)C1Cc1ccc(O)c(O)c1 |
|---|
| InChI Key | NFWHNQANQSCHGT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | furanoid lignans |
|---|
| Subclass | tetrahydrofuran lignans |
|---|
| Direct Parent | dibenzylbutyrolactone lignans |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativeslignan lactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compounddibenzylbutyrolactone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelignan lactonelactoneorganic oxideorganoheterocyclic compoundtetrahydrofuran1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
