| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:00 UTC |
|---|
| Update Date | 2025-03-21 17:56:49 UTC |
|---|
| HMDB ID | HMDB0031159 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003852 |
|---|
| Name | Garcinia acid |
|---|
| Frequency | 1498.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8O8 |
|---|
| Molecular Mass | 208.0219 |
|---|
| SMILES | O=C(O)CC(O)(C(=O)O)C(O)C(=O)O |
|---|
| InChI Key | ZMJBYMUCKBYSCP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonosaccharidesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidetricarboxylic acid or derivativeshydroxy acidbeta-hydroxy acidtertiary alcoholsaccharideorganic oxideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound1,2-diol |
|---|
