Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:35:01 UTC |
---|
Update Date | 2025-03-21 17:56:49 UTC |
---|
HMDB ID | HMDB0041672 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00003886 |
---|
Name | 4'-Hydroxyenterolactone |
---|
Frequency | 1479.4 |
---|
Structure | |
---|
Chemical Formula | C18H18O5 |
---|
Molecular Mass | 314.1154 |
---|
SMILES | O=C1OCC(Cc2ccc(O)c(O)c2)C1Cc1cccc(O)c1 |
---|
InChI Key | MJMVFOFWTGVQBW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | lignans, neolignans and related compounds |
---|
Class | furanoid lignans |
---|
Subclass | tetrahydrofuran lignans |
---|
Direct Parent | dibenzylbutyrolactone lignans |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativeslignan lactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstetrahydrofurans |
---|
Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compounddibenzylbutyrolactone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelignan lactonelactoneorganic oxideorganoheterocyclic compoundtetrahydrofuran1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativebenzenoidorganooxygen compound |
---|