| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:01 UTC |
|---|
| Update Date | 2025-03-21 17:56:50 UTC |
|---|
| HMDB ID | HMDB0304913 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00003902 |
|---|
| Name | 5-Hydroxytryptophol sulfate |
|---|
| Frequency | 1472.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11NO5S |
|---|
| Molecular Mass | 257.0358 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc2[nH]cc(CCO)c2c1 |
|---|
| InChI Key | FOCUAJYUOXSNDS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolessulfuric acid monoesters |
|---|
| Substituents | alcoholsulfuric acid monoesterazacycleindoleheteroaromatic compoundindole or derivativesorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfatebenzenoidorganic nitrogen compoundsulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|
