| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:10 UTC |
|---|
| Update Date | 2025-03-21 17:56:53 UTC |
|---|
| HMDB ID | HMDB0034004 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00004256 |
|---|
| Name | 3,4',7-Trihydroxyflavone |
|---|
| Frequency | 1322.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O5 |
|---|
| Molecular Mass | 270.0528 |
|---|
| SMILES | O=c1c(O)c(-c2ccc(O)cc2)oc2cc(O)ccc12 |
|---|
| InChI Key | OBWHQJYOOCRPST-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavones |
|---|
| Direct Parent | flavonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids3-hydroxyflavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | 3-hydroxyflavonemonocyclic benzene moiety3-hydroxyflavonoidbenzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyran7-hydroxyflavonoidpyranone4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
