Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:35:13 UTC |
---|
Update Date | 2025-03-21 17:56:54 UTC |
---|
HMDB ID | HMDB0001562 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00004375 |
---|
Name | Folinic acid |
---|
Frequency | 1316.4 |
---|
Structure | |
---|
Chemical Formula | C20H23N7O7 |
---|
Molecular Mass | 473.1659 |
---|
SMILES | Nc1nc2c(c(=O)[nH]1)N(C=O)C(CNc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1)CN2 |
---|
InChI Key | VVIAGPKUTFNRDU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | glutamic acid and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | alpha amino acidsamino acidsazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesheteroaromatic compoundshippuric acids and derivativeshydrocarbon derivativesimidolactamslactamsn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary aminespterins and derivativespyrimidonessecondary alkylarylaminessecondary carboxylic acid amidestertiary carboxylic acid amidesvinylogous amides |
---|
Substituents | monocyclic benzene moietycarbonyl grouplactamcarboxylic acidamino acidbenzoylpyrimidonebenzamidepyrimidineorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundimidolactamorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesvinylogous amidepterinazacyclen-acyl-alpha-amino acidhippuric acid or derivativesheteroaromatic compoundbenzoic acid or derivativesglutamic acid or derivativessecondary aminecarboxamide groupsecondary aliphatic/aromatic aminesecondary carboxylic acid amideorganic oxygen compounddicarboxylic acid or derivativesphenylalkylaminehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
---|