| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:14 UTC |
|---|
| Update Date | 2025-03-21 17:56:54 UTC |
|---|
| HMDB ID | HMDB0034043 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00004391 |
|---|
| Name | Tricetanidin |
|---|
| Frequency | 1282.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H11O6+ |
|---|
| Molecular Mass | 287.055 |
|---|
| SMILES | Oc1cc(O)c2ccc(-c3cc(O)c(O)c(O)c3)[o+]c2c1 |
|---|
| InChI Key | CMPNIWQMRYYTMK-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 5-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsanthocyanidinsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsorganooxygen compoundsoxacyclic compoundspyrogallols and derivatives |
|---|
| Substituents | monocyclic benzene moietybenzopyranpyrogallol derivative1-benzopyranbenzenetriolheteroaromatic compound5-hydroxyflavonoid1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compoundaromatic heteropolycyclic compound7-hydroxyflavonoid4'-hydroxyflavonoidanthocyanidinphenolhydrocarbon derivativebenzenoidorganic cationorganoheterocyclic compoundorganooxygen compound |
|---|
