| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:35:17 UTC |
|---|
| Update Date | 2025-03-21 17:56:55 UTC |
|---|
| HMDB ID | HMDB0240642 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00004509 |
|---|
| Name | 3,5-Di-tert-butyl-4-hydroxybenzoic acid |
|---|
| Frequency | 1247.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22O3 |
|---|
| Molecular Mass | 250.1569 |
|---|
| SMILES | CC(C)(C)c1cc(C(=O)O)cc(C(C)(C)C)c1O |
|---|
| InChI Key | YEXOWHQZWLCHHD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | hydroxybenzoic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenolsphenylpropanes |
|---|
| Substituents | carboxylic acidbenzoylcarboxylic acid derivativehydroxybenzoic acidphenylpropanearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzoic acidorganooxygen compound |
|---|
