| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:19 UTC |
|---|
| Update Date | 2025-03-21 17:56:56 UTC |
|---|
| HMDB ID | HMDB0001474 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00004586 |
|---|
| Name | 3,4-Dihydroxyphenylglycol O-sulfate |
|---|
| Frequency | 1219.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O7S |
|---|
| Molecular Mass | 250.0147 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc(C(O)CO)cc1O |
|---|
| InChI Key | MFYFKAXYRXODPL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaromatic alcoholshydrocarbon derivativesorganic oxidesphenoxy compoundsprimary alcoholssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietysulfuric acid monoester1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundsecondary alcoholsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterprimary alcoholorganooxygen compound1,2-diol |
|---|
