| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:19 UTC |
|---|
| Update Date | 2025-03-21 17:56:56 UTC |
|---|
| HMDB ID | HMDB0011648 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00004601 |
|---|
| Name | 1-(beta-D-Ribofuranosyl)-1,4-dihydronicotinamide |
|---|
| Frequency | 1214.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N2O5 |
|---|
| Molecular Mass | 256.1059 |
|---|
| SMILES | NC(=O)C1=CN(C2OC(CO)C(O)C2O)C=CC1 |
|---|
| InChI Key | MAKBMGXNXXXBFE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | n-substituted nicotinamides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdihydropyridinesenamineshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary carboxylic acid amidessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupmonosaccharidecarboxylic acid derivativesaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddihydropyridineprimary alcoholalcoholvinylogous amideazacycletetrahydrofurancarboxamide groupn-substituted nicotinamideoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundenamine |
|---|
