| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:20 UTC |
|---|
| Update Date | 2025-03-21 17:56:57 UTC |
|---|
| HMDB ID | HMDB0033740 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00004641 |
|---|
| Name | Narirutin |
|---|
| Frequency | 1203.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H32O14 |
|---|
| Molecular Mass | 580.1792 |
|---|
| SMILES | CC1OC(OCC2OC(Oc3cc(O)c4c(c3)OC(c3ccc(O)cc3)CC4=O)C(O)C(O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | HXTFHSYLYXVTHC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid-7-o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids5-hydroxyflavonoidsacetalsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeschromonesflavanoneshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol etherssecondary alcoholsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketone1-benzopyranflavanoneflavan1-hydroxy-2-unsubstituted benzenoidmonosaccharidealkyl aryl etherketonesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundchromaneoxaneorganoheterocyclic compoundflavonoid-7-o-glycosidealcoholbenzopyran5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|