Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:35:21 UTC |
---|
Update Date | 2025-03-21 17:56:57 UTC |
---|
HMDB ID | HMDB0028782 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00004671 |
---|
Name | Cysteinyl-Phenylalanine |
---|
Frequency | 1232.3 |
---|
Structure | |
---|
Chemical Formula | C12H16N2O3S |
---|
Molecular Mass | 268.0882 |
---|
SMILES | NC(CS)C(=O)NC(Cc1ccccc1)C(=O)O |
---|
InChI Key | XZFYRXDAULDNFX-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alkylthiolsalpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidscysteine and derivativeshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfur compoundsphenylalanine and derivativesphenylpropanoic acidssecondary carboxylic acid amides |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidalpha-amino acid or derivativesorganosulfur compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesalpha-amino acid amiden-acyl-alpha-amino acidcarboxamide grouparomatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundcysteine or derivativeshydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundalkylthiolorganooxygen compound |
---|