| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:35:25 UTC |
|---|
| Update Date | 2025-03-21 17:56:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00004838 |
|---|
| Frequency | 1140.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O3 |
|---|
| Molecular Mass | 226.063 |
|---|
| SMILES | O=C(O)c1ccccc1C(=O)c1ccccc1 |
|---|
| InChI Key | FGTYTUFKXYPTML-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsaryl ketonesaryl-phenylketonesbenzoic acidsbenzoyl derivativesdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | diphenylmethanecarboxylic acidaryl-phenylketonebenzoylbenzoic acid or derivativescarboxylic acid derivativebenzophenoneketonearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compoundaryl ketone |
|---|
