| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:35:26 UTC |
|---|
| Update Date | 2025-03-21 17:56:58 UTC |
|---|
| HMDB ID | HMDB0000845 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00004862 |
|---|
| Name | Neopterin |
|---|
| Frequency | 2025.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N5O4 |
|---|
| Molecular Mass | 253.0811 |
|---|
| SMILES | Nc1nc2[nH]cc(C(O)C(O)CO)nc-2c(=O)n1 |
|---|
| InChI Key | BMQYVXCPAOLZOK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholpterinazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundprimary alcoholamineorganooxygen compound |
|---|
