| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:35:27 UTC |
|---|
| Update Date | 2025-03-21 17:56:59 UTC |
|---|
| HMDB ID | HMDB0246603 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00004920 |
|---|
| Name | 4,4'-Dihydroxystilbene |
|---|
| Frequency | 1114.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O2 |
|---|
| Molecular Mass | 212.0837 |
|---|
| SMILES | Oc1ccc(C=Cc2ccc(O)cc2)cc1 |
|---|
| InChI Key | XLAIWHIOIFKLEO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesorganooxygen compounds |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietyorganic oxygen compound1-hydroxy-2-unsubstituted benzenoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundstilbene |
|---|
