Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:35:31 UTC |
---|
Update Date | 2025-03-21 17:57:00 UTC |
---|
HMDB ID | HMDB0000735 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00005051 |
---|
Name | Hydroxyphenylacetylglycine |
---|
Frequency | 1078.6 |
---|
Structure | |
---|
Chemical Formula | C10H11NO4 |
---|
Molecular Mass | 209.0688 |
---|
SMILES | O=C(O)CN=C(O)Cc1ccc(O)cc1 |
---|
InChI Key | CPPDWYIPKSSNNM-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | alpha amino acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboximidic acidscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compounds |
---|
Substituents | carboximidic acidmonocyclic benzene moietycarbonyl groupcarboxylic acid1-hydroxy-2-unsubstituted benzenoidorganic 1,3-dipolar compoundpropargyl-type 1,3-dipolar organic compoundaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
---|