| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:35:33 UTC |
|---|
| Update Date | 2025-03-21 17:57:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005108 |
|---|
| Frequency | 1074.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H20N2O2S |
|---|
| Molecular Mass | 256.1245 |
|---|
| SMILES | CC(=O)NCCSCc1ccc(CN(C)C)o1 |
|---|
| InChI Key | NRJJZKLHFSKVJY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | aralkylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkylthioethersfuransheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundssecondary carboxylic acid amidessulfenyl compoundstrialkylamines |
|---|
| Substituents | furancarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesorganosulfur compoundcarboxylic acid derivativearalkylamineorganic oxideorganopnictogen compoundtertiary amineorganoheterocyclic compoundacetamidesulfenyl compounddialkylthioetherheteroaromatic compoundtertiary aliphatic aminecarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundthioetherhydrocarbon derivativeorganooxygen compound |
|---|
