| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:35:35 UTC |
|---|
| Update Date | 2025-03-21 17:57:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005194 |
|---|
| Frequency | 1040.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16O8 |
|---|
| Molecular Mass | 252.0845 |
|---|
| SMILES | CC(OC1OC(CO)C(O)C(O)C1O)C(=O)O |
|---|
| InChI Key | UHBAFOKDFZXQAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesacetalaliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compound |
|---|