| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:35:38 UTC |
|---|
| Update Date | 2025-03-21 17:57:02 UTC |
|---|
| HMDB ID | HMDB0001068 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005290 |
|---|
| Name | D-Sedoheptulose 7-phosphate |
|---|
| Frequency | 1017.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H15O10P |
|---|
| Molecular Mass | 290.0403 |
|---|
| SMILES | O=P(O)(O)OCC1OC(O)(CO)C(O)C(O)C1O |
|---|
| InChI Key | CBIDVWSRUUODHL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholoxacycleorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholhexose phosphatehemiacetalhydrocarbon derivativeoxaneorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compound |
|---|