| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:40 UTC |
|---|
| Update Date | 2025-03-21 17:57:03 UTC |
|---|
| HMDB ID | HMDB0301785 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005395 |
|---|
| Name | 4-O-(Indole-3-acetyl)-D-glucopyranose |
|---|
| Frequency | 992.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H19NO7 |
|---|
| Molecular Mass | 337.1162 |
|---|
| SMILES | O=C(Cc1c[nH]c2ccccc12)OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | HHDMMUWDSFASNB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acid estersheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyrrolessecondary alcohols |
|---|
| Substituents | carbonyl groupindolemonosaccharidecarboxylic acid derivativesaccharideorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholalcoholazacycleheteroaromatic compoundoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterpyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
