| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:35:42 UTC |
|---|
| Update Date | 2025-03-21 17:57:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005447 |
|---|
| Frequency | 990.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14NO8P |
|---|
| Molecular Mass | 271.0457 |
|---|
| SMILES | CC(=O)NC1C(OP(=O)(O)O)OC(CO)C1O |
|---|
| InChI Key | ZUAUMLBSMXJOBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl groupmonosaccharidecarboxylic acid derivativesaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundacetamidealcoholtetrahydrofurancarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
