| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:42 UTC |
|---|
| Update Date | 2025-03-21 17:57:04 UTC |
|---|
| HMDB ID | HMDB0000559 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005461 |
|---|
| Name | 3-Methoxy-4-hydroxyphenylethyleneglycol sulfate |
|---|
| Frequency | 978.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12O7S |
|---|
| Molecular Mass | 264.0304 |
|---|
| SMILES | COc1cc(C(O)CO)ccc1OS(=O)(=O)O |
|---|
| InChI Key | WUFPNASKMLJSND-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl aryl ethersanisolesaromatic alcoholshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compoundsprimary alcoholssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | aromatic alcoholphenol ethermonocyclic benzene moietysulfuric acid monoesteretheralkyl aryl etherphenylsulfateorganic oxideprimary alcohol1,2-diolalcoholmethoxybenzenearomatic homomonocyclic compoundorganic oxygen compoundanisolesecondary alcoholsulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
