| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:35:43 UTC |
|---|
| Update Date | 2025-03-21 17:57:04 UTC |
|---|
| HMDB ID | HMDB0141548 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005494 |
|---|
| Name | 2-hydroxy-3-(3,4,5-trihydroxyphenyl)propanoic acid |
|---|
| Frequency | 972.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O6 |
|---|
| Molecular Mass | 214.0477 |
|---|
| SMILES | O=C(O)C(O)Cc1cc(O)c(O)c(O)c1 |
|---|
| InChI Key | YZPVUGFINSRDPI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha hydroxy acids and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidespyrogallols and derivativessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl groupcarboxylic acidpyrogallol derivative3-phenylpropanoic-acidbenzenetriolalpha-hydroxy acid1-hydroxy-2-unsubstituted benzenoidhydroxy acid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
