| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:35:47 UTC |
|---|
| Update Date | 2025-03-21 17:57:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005632 |
|---|
| Frequency | 942.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8O8 |
|---|
| Molecular Mass | 220.0219 |
|---|
| SMILES | O=C(O)CC(CC(=O)O)(C(=O)O)C(=O)O |
|---|
| InChI Key | JXHDZGPVOXKUSI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl grouporganic oxidecarboxylic acidorganic oxygen compoundhydrocarbon derivativetetracarboxylic acid or derivativesorganooxygen compound |
|---|
