| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:47 UTC |
|---|
| Update Date | 2025-03-21 17:57:06 UTC |
|---|
| HMDB ID | HMDB0012468 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005636 |
|---|
| Name | (-)-Epigallocatechin sulfate |
|---|
| Frequency | 940.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O10S |
|---|
| Molecular Mass | 386.0308 |
|---|
| SMILES | O=S(=O)(O)OC1Cc2cc(O)cc(O)c2OC1c1cc(O)c(O)c(O)c1 |
|---|
| InChI Key | PFNBTZIECYHRTC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | sulfated flavonoids |
|---|
| Direct Parent | 3-sulfated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids6-hydroxyflavonoids8-hydroxyflavonoidsalkyl aryl ethersalkyl sulfatesbenzene and substituted derivativesflavan-3-olshydrocarbon derivativesorganic oxidesoxacyclic compoundspyrogallols and derivativessulfuric acid monoesters |
|---|
| Substituents | 8-hydroxyflavonoidmonocyclic benzene moietysulfuric acid monoesterether1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidearomatic heteropolycyclic compoundalkyl sulfatechromaneflavan-3-olorganoheterocyclic compoundbenzopyranorganic sulfuric acid or derivativespyrogallol derivativebenzenetriol3-sulfated flavonoid6-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound4'-hydroxyflavonoidsulfate-esterphenolhydrocarbon derivativebenzenoidsulfuric acid esterorganooxygen compound |
|---|