| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:48 UTC |
|---|
| Update Date | 2025-03-21 17:57:06 UTC |
|---|
| HMDB ID | HMDB0240565 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005678 |
|---|
| Name | Umbelliferone sulfate |
|---|
| Frequency | 932.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H6O6S |
|---|
| Molecular Mass | 241.9885 |
|---|
| SMILES | O=c1ccc2ccc(OS(=O)(=O)O)cc2o1 |
|---|
| InChI Key | LJOOSFYJELZGMR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransarylsulfatesbenzenoidsheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterbenzopyranorganic sulfuric acid or derivatives1-benzopyranheteroaromatic compoundcoumarinlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonesulfate-esterhydrocarbon derivativearylsulfatebenzenoidsulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|
