| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:49 UTC |
|---|
| Update Date | 2025-03-21 17:57:06 UTC |
|---|
| HMDB ID | HMDB0303660 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005721 |
|---|
| Name | Leucocyanidin |
|---|
| Frequency | 923.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O7 |
|---|
| Molecular Mass | 306.074 |
|---|
| SMILES | Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2O |
|---|
| InChI Key | SBZWTSHAFILOTE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavans |
|---|
| Direct Parent | catechins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids3-hydroxyflavonoids4'-hydroxyflavonoids4-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesleucoanthocyanidinsoxacyclic compoundssecondary alcohols |
|---|
| Substituents | monocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl ether4-hydroxyflavonoidaromatic heteropolycyclic compoundleucoanthocyanidin-skeletonchromanecatechinorganoheterocyclic compound1,2-diolalcoholbenzopyran5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|