| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:35:52 UTC |
|---|
| Update Date | 2025-03-21 17:57:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005828 |
|---|
| Frequency | 903.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H20O6 |
|---|
| Molecular Mass | 380.126 |
|---|
| SMILES | OCC1OC(Oc2ccc3ccc4cccc5ccc2c3c45)C(O)C(O)C1O |
|---|
| InChI Key | IVDHRIULYZCJBR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | pyrenes |
|---|
| Subclass | pyrenes |
|---|
| Direct Parent | pyrenes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalshydrocarbon derivativesmonosaccharidesnaphthalenesoxacyclic compoundsoxanesphenanthrenes and derivativesphenol ethersprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol etherphenanthrenemonosaccharideoxacyclepyrenesaccharidenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|