| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:35:54 UTC |
|---|
| Update Date | 2025-03-21 17:57:08 UTC |
|---|
| HMDB ID | HMDB0135258 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005893 |
|---|
| Name | [2-hydroxy-5-(prop-2-en-1-yl)phenyl]oxidanesulfonic acid |
|---|
| Frequency | 891.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O5S |
|---|
| Molecular Mass | 230.0249 |
|---|
| SMILES | C=CCc1ccc(O)c(OS(=O)(=O)O)c1 |
|---|
| InChI Key | NZJJNEPAJGOQNB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidshydrocarbon derivativesorganic oxidesorganooxygen compoundsphenoxy compoundssulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoester1-hydroxy-2-unsubstituted benzenoidaromatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
