| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:35:54 UTC |
|---|
| Update Date | 2025-03-21 17:57:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005899 |
|---|
| Frequency | 891.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H32O16 |
|---|
| Molecular Mass | 504.169 |
|---|
| SMILES | OCC1OC(O)C(O)C(O)C1OC1OC(CO)C(OC2C(CO)OC(O)C(O)C2O)C(O)C1O |
|---|
| InChI Key | KFCMYDMTPCPYAG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsdialkyl ethershemiacetalshydrocarbon derivativesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholethermonosaccharidedialkyl etheroxacycleacetalaliphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compound |
|---|