| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:35:55 UTC |
|---|
| Update Date | 2025-03-21 17:57:09 UTC |
|---|
| HMDB ID | HMDB0001491 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005951 |
|---|
| Name | Pyridoxal 5'-phosphate |
|---|
| Frequency | 883.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10NO6P |
|---|
| Molecular Mass | 247.0246 |
|---|
| SMILES | Cc1ncc(COP(=O)(O)O)c(C=O)c1O |
|---|
| InChI Key | NGVDGCNFYWLIFO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridine carboxaldehydes |
|---|
| Direct Parent | pyridoxals and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl-aldehydesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonoalkyl phosphatesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinespyridinecarboxylic acids and derivativesvinylogous acids |
|---|
| Substituents | pyridine carboxylic acid or derivativesaromatic heteromonocyclic compoundpolyhalopyridineorganic oxidearyl-aldehydeorganonitrogen compoundorganopnictogen compound2-halopyridinepyridoxalazacycleheteroaromatic compoundhydroxypyridinealdehydevinylogous acidorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
