| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:35:56 UTC |
|---|
| Update Date | 2025-03-21 17:57:08 UTC |
|---|
| HMDB ID | HMDB0127988 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00005973 |
|---|
| Name | (4-ethyl-2-methoxyphenyl)oxidanesulfonic acid |
|---|
| Frequency | 878.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12O5S |
|---|
| Molecular Mass | 232.0405 |
|---|
| SMILES | CCc1ccc(OS(=O)(=O)O)c(OC)c1 |
|---|
| InChI Key | MKBJQFWSHNXYFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisoleshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compoundssulfuric acid monoesters |
|---|
| Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoesteretheralkyl aryl ethermethoxybenzenearomatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundanisolesulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
