| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:59 UTC |
|---|
| Update Date | 2025-03-21 17:57:10 UTC |
|---|
| HMDB ID | HMDB0240455 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006077 |
|---|
| Name | 4-Hydroxy-5-(3',5'-dihydroxyphenyl)-valeric acid |
|---|
| Frequency | 859.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14O5 |
|---|
| Molecular Mass | 226.0841 |
|---|
| SMILES | O=C(O)CCC(O)Cc1cc(O)cc(O)c1 |
|---|
| InChI Key | QKRQBODPNMXFLS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | carbocyclic fatty acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativeshydroxy fatty acidsmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesmonocarboxylic acids and derivativesorganic oxidesresorcinolssecondary alcohols |
|---|
| Substituents | alcoholcarbocyclic fatty acidmonocyclic benzene moietycarbonyl groupcarboxylic acid1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativemedium-chain hydroxy acidresorcinolaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativemedium-chain fatty acidhydroxy fatty acidbenzenoidorganooxygen compound |
|---|
