| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:35:59 UTC |
|---|
| Update Date | 2025-03-21 17:57:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006079 |
|---|
| Frequency | 859.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O8P |
|---|
| Molecular Mass | 244.0348 |
|---|
| SMILES | O=CC(O)COP(=O)(O)OCC(O)CO |
|---|
| InChI Key | XGQYCPGLWXFLOP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glyceraldehyde-3-phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxyaldehydesdialkyl phosphateshydrocarbon derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupaldehydedialkyl phosphateorganic oxidealpha-hydroxyaldehydeglyceraldehyde-3-phosphatephosphoric acid estersecondary alcoholhydrocarbon derivativeprimary alcoholorganic phosphoric acid derivativealkyl phosphate |
|---|