| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:35:59 UTC |
|---|
| Update Date | 2025-03-21 17:57:09 UTC |
|---|
| HMDB ID | HMDB0002065 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006090 |
|---|
| Name | 6-Lactoyltetrahydropterin |
|---|
| Frequency | 857.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N5O3 |
|---|
| Molecular Mass | 239.1018 |
|---|
| SMILES | CC(O)C(=O)C1CNc2[nH]c(N)nc(=O)c2N1 |
|---|
| InChI Key | HKCYZTKHPLJZDR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acyloinsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesketonesorganic oxidesorganopnictogen compoundsprimary aminespyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | carbonyl grouppyrimidonepyrimidineketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholvinylogous amidepterinazacycleheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundacyloinsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
