| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:04 UTC |
|---|
| Update Date | 2025-03-21 17:57:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006266 |
|---|
| Frequency | 828.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6O8S |
|---|
| Molecular Mass | 249.9783 |
|---|
| SMILES | O=C(OS(=O)(=O)O)c1ccc(O)c(O)c1O |
|---|
| InChI Key | LWSRNRDHCHMXEY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-unsubstituted pyrrogallolsbenzoic acids and derivativesbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundssulfuric acid monoestersvinylogous acids |
|---|
| Substituents | sulfuric acid monoesterorganic sulfuric acid or derivativespyrogallol derivativebenzenetriolbenzoyl1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundvinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivatives5-unsubstituted pyrrogallolphenolhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|
