Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:36:06 UTC |
---|
Update Date | 2025-03-21 17:57:12 UTC |
---|
HMDB ID | HMDB0003263 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00006344 |
---|
Name | Pelargonidin |
---|
Frequency | 817.0 |
---|
Structure | |
---|
Chemical Formula | C15H11O5+ |
---|
Molecular Mass | 271.0601 |
---|
SMILES | Oc1ccc(-c2[o+]c3cc(O)cc(O)c3cc2O)cc1 |
---|
InChI Key | XVFMGWDSJLBXDZ-UHFFFAOYSA-O |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | hydroxyflavonoids |
---|
Direct Parent | 3-hydroxyflavonoids |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsanthocyanidinsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsorganooxygen compoundsoxacyclic compounds |
---|
Substituents | 3-hydroxyflavonoidmonocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundaromatic heteropolycyclic compound7-hydroxyflavonoid4'-hydroxyflavonoidanthocyanidinphenolhydrocarbon derivativebenzenoidorganic cationorganoheterocyclic compoundorganooxygen compound |
---|