| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:36:06 UTC |
|---|
| Update Date | 2025-03-21 17:57:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006372 |
|---|
| Frequency | 1209.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9N5O3 |
|---|
| Molecular Mass | 223.0705 |
|---|
| SMILES | Nc1nc2ncc(C(O)CO)nc2c(=O)[nH]1 |
|---|
| InChI Key | CZFDAUYUFPTCCG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsaromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | aromatic alcohollactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcohol1,2-diolalcoholpterinazacycleheteroaromatic compoundorganic oxygen compoundpyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
