| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:36:07 UTC |
|---|
| Update Date | 2025-03-21 17:57:13 UTC |
|---|
| HMDB ID | HMDB0033739 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006404 |
|---|
| Name | Floribundoside |
|---|
| Frequency | 805.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H22O10 |
|---|
| Molecular Mass | 434.1213 |
|---|
| SMILES | O=C1CC(c2ccc(O)cc2)Oc2cc(O)cc(OC3OC(CO)C(O)C(O)C3O)c21 |
|---|
| InChI Key | MFQIWHVVFBCURA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoids7-hydroxyflavonoidsacetalsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeschromonesflavanoneshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersprimary alcoholssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketone1-benzopyranflavanoneflavan1-hydroxy-2-unsubstituted benzenoidmonosaccharidealkyl aryl etherketonesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundchromaneoxaneprimary alcoholorganoheterocyclic compoundalcoholbenzopyranflavonoid-5-o-glycosideflavonoid o-glycosideoxacycleorganic oxygen compound7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
