| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:36:09 UTC |
|---|
| Update Date | 2025-03-21 17:57:13 UTC |
|---|
| HMDB ID | HMDB0246316 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00006464 |
|---|
| Name | 4-[(2,4-Dihydroxy-3,3-dimethylbutanoyl)amino]butanoic acid |
|---|
| Frequency | 798.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19NO5 |
|---|
| Molecular Mass | 233.1263 |
|---|
| SMILES | CC(C)(CO)C(O)C(=O)NCCCC(=O)O |
|---|
| InChI Key | SBBDHANTMHIRGW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | gamma amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | branched fatty acidscarbonyl compoundscarboxylic acidshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesmonosaccharidesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amidesshort-chain hydroxy acids and derivatives |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidgamma amino acid or derivativesfatty amidemonosaccharidefatty acidsaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundhydroxy fatty acidalcoholcarboxamide groupbranched fatty acidn-acyl-aminesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
